LT-540-717 | MedChemExpress (MCE)
LT-540-717 (compound 32) is a potent FLT3 inhibitor (IC50=0.62 nM) with antiproliferative activity. LT-540-717 also inhibits several acquired FLT3 mutations, FLT3 (ITD, D835V), FLT3 (ITD, F691L), FLT3 (D835Y) and FLT3 (D835V). LT-540-717 has potential to be an anti-AML agent[1].
| Trivial name | LT-540-717 |
| Catalog Number | HY-155594 |
| Research Area | Cancer |
| CAS# | 2143089-35-2 |
| Purity | ≥98.00% |
| SMILES | O=C(NC1=CC=C(N2CCNCC2)C=C1)C3=NNC=C3NC4=NC=NC(OC5=CC=CC=C5)=C4 |
| PubChem Chemical Structure ID | 151772999 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lt-540-717.html |