Demethylsuberosin
Demethylsuberosin, a natural product isolated and purified from the root of Angelica dahuricae, displays suppressive effects on LPS-induced NO and PGE2 production with the IC50 value of 9.42 uM, suggesting that it has potential anti-inflammatory activity.
| Trivial name | 7-Demethylsuberosin |
| Catalog Number | CSN14220 |
| Alternative Name(s) | 7-Demethylsuberosin |
| Research Area | / |
| Molecular Formula | C14H14O3 |
| CAS# | 21422-04-8 |
| Purity | ≥98% |
| SMILES | O=C1C=CC2=CC(C/C=C(C)\C)=C(O)C=C2O1 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/demethylsuberosin.html |