Bisoprolol D5 Fumarate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02642 |
| Alternative Name(s) | 1-[4-[[2-(1-Methylethoxy)ethoxy]methyl]phenoxy]-3-[(1-methylethyl)amino]-2-propanol-d5 fumarate; |
| Research Area | A selective Beta-adrenergic blocker. Used as an antihypertensive.;Labeled Bisoprolol, intended for use as an internal standard for the quantification of Bisoprolol by GC- or LC-mass spectrometry. |
| Molecular Formula | C22H30D5NO8 |
| CAS# | 2140803-85-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(/C=C/C(O)=O)=O.OC(C([2H])([2H])NC(C)C)([2H])C([2H])([2H])OC1=CC=C(COCCOC(C)C)C=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02642.html |
| Additional Information | NULL |