25-hydroxy Cholesterol 100mg
25-hydroxy Cholesterol is a side-chain substituted oxysterol derived from dietary cholesterol that inhibits the cleavage of sterol regulatory element binding proteins (SREBPs) to suppress endogenous cholesterol synthesis in various cell types
| Trivial name | 25-hydroxy Cholesterol 100mg |
| Catalog Number | A13704-100 |
| Alternative Name(s) | cholest-5-ene-3b,25-diol |
| Molecular Formula | C27H46O2 |
| CAS# | 2140-46-7 |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/25-hydroxy-cholesterol.html |