Lansoprazole N-Oxide
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-O-06039 |
| Alternative Name(s) | Lansoprazole EP Impurity A;2-[[[3-Methyl-1-oxido-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]sulfinyl]-1H-benzimidazole;2-[(1H-1,3-benzodiazole-2-sulfinyl)methyl]-3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-1-ium-1-olate |
| Research Area | An impurity of Lansoprazole formed during the bulk synthesis of the drug. |
| Molecular Formula | C16H14F3N3O3S |
| CAS# | 213476-12-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](C1=NC(C=CC=C2)=C2N1)CC([N](=O)=CC=C3OCC(F)(F)F)=C3C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06039.html |
| Additional Information | NULL |