RITA (NSC 652287) 10mM * 1mL in DMSO
RITA, also referred to as NSC 652287, is a trycyclic thiophene derivative that binds to MDM2, disrupting the MDM2-p53 complex and subsequently activating p53 and inducing apoptosis.
| Trivial name | RITA (NSC 652287) 10mM * 1mL in DMSO |
| Catalog Number | A11931-10mM-D |
| Alternative Name(s) | 5,5'-(2,5-Furandiyl)bis-2-thiophenemethanol |
| Molecular Formula | C14H12O3S2 |
| CAS# | 213261-59-7 |
| SMILES | C1=C(SC(=C1)C2=CC=C(O2)C3=CC=C(S3)CO)CO |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/rita-nsc-652287.html |