Alflutinib (Furmonertinib) mesylate
Alflutinib (Furmonertinib) mesylate is a third-generation epidermal growth factor receptor (EGFR) inhibitor that inhibits both EGFR-sensitive mutations and T790M mutations. Alflutinib (AST2818), primarily metabolized by CYP3A4, is also a potent CYP3A4 inducer with EC50 of 0.25 μM.
| Trivial name | AST2818 mesylate |
| Catalog Number | S6868 |
| Molecular Formula | C29H35F3N8O5S |
| CAS# | 2130958-55-1 |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=NC(=NC=C3)NC4=C(N=C(C(=C4)NC(=O)C=C)N(C)CCN(C)C)OCC(F)(F)F |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/alflutinib-ast2818-mesylate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6868-alflutinib-ast2818-mesylate-chemical-structure.gif |