Purvalanol B
Purvalanol B (NG-95) is a potent and selective inhibitor of cyclin-dependent kinase (CDK) with IC50 of 6 nM, 6 nM, 9 nM and 6 nM for cdc2-cyclin B, CDK2-cyclin A, CDK2-cyclin E and CDK5-p35, respectively.
| Trivial name | NG 95 |
| Catalog Number | S0500 |
| Molecular Formula | C20H25ClN6O3 |
| CAS# | 212844-54-7 |
| SMILES | CC(C)C(CO)NC1=NC(=C2C(=N1)N(C=N2)C(C)C)NC3=CC(=C(C=C3)C(=O)O)Cl |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/purvalanol-b-ng-95.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s0500-purvalanol-b-chemical-structure.gif |