Purvalanol B
Purvalanol B is a selective cyclin-dependent kinases (CDKs) inhibitor with IC50 values of 6, 6, 9, > 10,000, and 6 nM for cdc2/cyclin B, cdk2/cyclin A, cdk2/cyclin E, cdk4/cyclin D1 and cdk5-p35 respectively.
| Trivial name | NG 95 |
| Catalog Number | CSN16119 |
| Alternative Name(s) | NG 95 |
| Research Area | Cancer |
| Molecular Formula | C20H25ClN6O3 |
| CAS# | 212844-54-7 |
| Purity | ≥98% |
| SMILES | O=C(O)C1=CC=C(NC2=C3N=CN(C(C)C)C3=NC(N[C@@H](CO)C(C)C)=N2)C=C1Cl |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/purvalanol-b.html |
