Purvalanol A
Purvalanol A is a potent, and cell-permeable CDK inhibitor with IC50 of 4 nM, 70 nM, 35 nM, and 850 nM for cdc2-cyclin B, cdk2-cyclin A, cdk2-cyclin E, and cdk4-cyclin D1, respectively. Purvalanol A induces endoplasmic reticulum stress-mediated apoptosis and autophagy.
| Trivial name | N/A |
| Catalog Number | S7793 |
| Molecular Formula | C19H25ClN6O |
| CAS# | 212844-53-6 |
| Inchi | InChI=1S/C19H25ClN6O/c1-11(2)15(9-27)23-19-24-17(22-14-7-5-6-13(20)8-14)16-18(25-19)26(10-21-16)12(3)4/h5-8,10-12,15,27H,9H2,1-4H3,(H2,22,23,24,25)/t15-/m0/s1 |
| Inchi Key | PMXCMJLOPOFPBT-HNNXBMFYSA-N |
| SMILES | CC(C)C(CO)NC1=NC(=C2C(=N1)N(C=N2)C(C)C)NC3=CC(=CC=C3)Cl |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/purvalanol-a.html |
| Additional Information | https://file.selleck.cn/downloads/struct/purvalanol-a-chemical-structure-s7793.gif |