Purvalanol A
Purvalanol A is a selective inhibitor of cyclin-dependent kinases (CDKs), it potently inhibits cdc2/cyclin B, Cdk2/cyclin A, Cdk2/cyclin E, Cdk4/cyclin D1 and Cdk5-p35 with IC50 values of 4, 70, 35, 850, and 75 nM respectively.
| Trivial name | NG 60 |
| Catalog Number | CSN11800 |
| Alternative Name(s) | NG 60 |
| Research Area | Cancer |
| Molecular Formula | C19H25ClN6O |
| CAS# | 212844-53-6 |
| Purity | ≥99% |
| SMILES | CC(C)[C@@H](NC1=NC(NC2=CC=CC(Cl)=C2)=C3N=CN(C(C)C)C3=N1)CO |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/purvalanol-a.html |