Vatalanib 100mg
Vatalanib (PTK787 or PTK/ZK) is a small molecule protein kinase inhibitor that inhibits angiogenesis that inhibits all known VEGF receptors, as well as platelet-derived growth factor receptor-beta and c-kit, but is most selective for VEGFR-2.
Trivial name | Vatalanib 100mg |
Catalog Number | A10967-100 |
Alternative Name(s) | N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine dihydrochloride |
Molecular Formula | C20H17Cl3N4 |
CAS# | 212141-54-3 |
SMILES | C1=CC=C2C(=C1)C(=NN=C2NC3=CC=C(C=C3)Cl)CC4=CC=NC=C4.Cl.Cl |
Size | 100mg |
Supplier Page | http://www.adooq.com/vatalanib-ptk787-dihydrochloride-base.html |