Dabigatran (BIBR-1048) etexilate
Dabigatran Etexilate (BIBR-1048) is the prodrug of dabigatran, a potent, nonpeptidic small molecule that specifically and reversibly inhibits both free and clot-bound thrombin by binding to the active site of the thrombin molecule.
| Trivial name | BIBR-1048 |
| Catalog Number | S2154 |
| Molecular Formula | C24H25N5O.2HCl |
| CAS# | 211915-06-9 |
| Inchi | InChI=1S/C24H25N5O.2ClH/c1-2-12-28(13-3-1)14-15-30-22-6-4-19(5-7-22)21-16-26-24-23(17-27-29(24)18-21)20-8-10-25-11-9-20;;/h4-11,16-18H,1-3,12-15H2;2*1H |
| Inchi Key | RJDVIJJQKMGPMV-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CCOC2=CC=C(C=C2)C3=CN4C(=C(C=N4)C5=CC=NC=C5)N=C3.Cl.Cl |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/BIBR-1048(Dabigatran-etexilate).html |
| Additional Information | https://file.selleck.cn/downloads/struct/BIBR-1048-Dabigatran-chemical-structure-S2154.gif |
