WHI-P 154 50mg
WHI-P 154 is a JAK3 inhibitor with IC50 = 1.8uM. WHI-P 154 also Inhibits STAT1 activation, iNOS expression and NO production in macrophages in vitro.
| Trivial name | WHI-P 154 50mg |
| Catalog Number | A14049-50 |
| Alternative Name(s) | 2-Bromo-4-[(6,7-dimethoxy-4-quinazolinyl)amino]phenol |
| Molecular Formula | C16H14BrN3O3 |
| CAS# | 211555-04-3 |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)O)Br)OC |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/whi-p-154.html |
