SB 265610
SB265610, a competitive antagonist at the human CXCR2 receptor, can displace [125I]-IL-8 and [125I]-GROα with pIC50 values of 8.41 and 8.47 respectively, preventing receptor activation by binding to a region distinct from the agonist binding site.
| Trivial name | N/A |
| Catalog Number | S9516 |
| Molecular Formula | C14H9BrN6O |
| CAS# | 211096-49-0 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | BrC1=CC=CC=C1NC(=O)NC2=CC=C(C#N)C3=C2[NH]N=N3 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/sb-265610.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s9516-sb-265610-chemical-structure.gif |