BMY 7378 2HCl
BMY 7378 2HCl is a 5-HT1A partial agonist and a high-affinity α1D adrenoceptor antagonist with Ki values of 2, 800 and 600 nM for cloned rat α1D, rat α1A and hamster α1B receptors respectively.
| Trivial name | / |
| Catalog Number | CSN13005 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C22H33Cl2N3O3 |
| CAS# | 21102-95-4 |
| Purity | ≥98% |
| SMILES | O=C(N(CCN1CCN(C2=CC=CC=C2OC)CC1)C(C3)=O)CC43CCCC4.[H]Cl.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/bmy-7378-2hcl.html |