Koenimbine | MedChemExpress (MCE)
Koenimbine is an anticancer agent that can be obtained from the leaves and fruits of Murraya koenigii. Koenimbine can induce apoptosis and necrosis in HT-29 and SW48 cells. Koenimbine can be used in the research of cancer[1].
| Trivial name | Koenimbine |
| Catalog Number | HY-W727999 |
| Research Area | Cancer |
| CAS# | 21087-98-9 |
| Purity | ≥98.00% |
| SMILES | CC1=CC2=C(NC3=C2C=C(C=C3)OC)C4=C1OC(C)(C=C4)C |
| PubChem Chemical Structure ID | 97487 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/koenimbine.html |