GSK-J2 sodium | MedChemExpress (MCE)
GSK-J2 sodium is the sodium form of GSK-J2 (HY-15648A). GSK-J2 is an isomer of GSK-J1, and does not have any specific activity. GSK-J1 (HY-15648) is a potent inhibitor of H3K27me3/me2-demethylases JMJD3/KDM6B and UTX/KDM6A[1].
| Trivial name | GSK-J2 sodium |
| Catalog Number | HY-15648I |
| Research Area | Cancer |
| CAS# | 2108665-15-0 |
| Purity | ≥98.0% |
| SMILES | O=C(CCNC1=CC(N2CCC3=C(CC2)C=CC=C3)=NC(C4=CN=CC=C4)=N1)O[Na] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/gsk-j2-sodium.html |