Z-VEID-FMK | MedChemExpress (MCE)
Z-VEID-FMK (Z-VE(OMe)ID(OMe)-FMK) is a selective and irreversible caspase-6 peptide inhibitor. Z-VEID-FMK alleviates the S-(+)-ketamine-induced augmentation of caspase-6 activity, DNA fragmentation, and cell apoptosis[1][2].
| Trivial name | Z-VEID-FMK |
| Catalog Number | HY-P1007 |
| Alternative Name(s) | Z-VE(OMe)ID(OMe)-FMK |
| Research Area | Cancer |
| CAS# | 210344-96-0 |
| Purity | ≥98.00% |
| SMILES | O=C(OCC1=CC=CC=C1)N[C@@H](C(C)C)C(N[C@@H](CCC(OC)=O)C(N[C@@H]([C@@H](C)CC)C(N[C@H](C(CF)=O)CC(OC)=O)=O)=O)=O |
| PubChem Chemical Structure ID | 25108683 |
| Size | 10 mg |
| Supplier Page | https://www.medchemexpress.com/z-veid-fmk.html |