JNJ-64264681 | MedChemExpress (MCE)
JNJ-64264681 is a potent, orally active, selective and irreversible covalent BTK inhibitor. JNJ-64264681 exhibits good pharmacokinetic characteristics and can be used for cancer and autoimmune diseases research[1].
| Trivial name | JNJ-64264681 |
| Catalog Number | HY-153245 |
| Research Area | Inflammation/Immunology; Cancer |
| CAS# | 2101524-34-7 |
| Purity | ≥98.00% |
| SMILES | C=CC(N[C@@H](CCC1)[C@@H]1NC(C2=C3C4=C(C=CN=C4S2)N(C5=CN=C(CC(C)C)C=C5C)C(N3)=O)=O)=O |
| PubChem Chemical Structure ID | 129234005 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/jnj-64264681.html |