YO-01027
Dibenzazepine is a dipeptidic γ-secretase inhibitor with IC50 of 2.6 nM and 2.9 nM in cell-free assays for APPL and Notch cleavage, respectively.
| Trivial name | Dibenzazepine; DBZ |
| Catalog Number | CSN13122 |
| Alternative Name(s) | Dibenzazepine; DBZ |
| Research Area | Cancer|Metabolic Disease |
| Molecular Formula | C26H23F2N3O3 |
| CAS# | 209984-56-5 |
| Purity | ≥99% |
| SMILES | C[C@H](NC(=O)CC1=CC(F)=CC(F)=C1)C(=O)N[C@H]1C2=CC=CC=C2C2=CC=CC=C2N(C)C1=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/yo-01027.html |