Tafluprost acid
Tafluprost acid (AFP-172), the active metabolite of Tafluprost, is a selective agonist of the prostanoid FP receptor, with Ki and IC50 of 0.4 nM and 0.53 nM, respectively, for the human prostanoid FP receptor. It also exhibits 126-fold weaker binding affinity for the prostanoid EP3 receptor, with an IC50 of 67 nM, compared to the FP receptor.
| Trivial name | AFP-172 |
| Catalog Number | E7166 |
| Molecular Formula | C7H8ClN3O4S2 |
| CAS# | 209860-88-8 |
| Inchi | InChI=1S/C7H8ClN3O4S2/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h1-2,10-11H,3H2,(H2,9,12,13) |
| Inchi Key | JZUFKLXOESDKRF-UHFFFAOYSA-N |
| SMILES | C1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl |
| Size | 1mg |
| Supplier Page | http://www.selleckchem.com/products/tafluprost-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E7166-Tafluprost-acid-chemical-structure.png |
