Entinostat (MS-275)
Entinostat (MS-275, SNDX-275) strongly inhibits HDAC1 and HDAC3 with IC50 of 0.51 μM and 1.7 μM in cell-free assays, compared with HDACs 4, 6, 8, and 10. Entinostat induces autophagy and apoptosis. Phase 3.
| Trivial name | SNDX-275 |
| Catalog Number | S1053 |
| Molecular Formula | C6H12O6 |
| CAS# | 209783-80-2 |
| Inchi | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5-,6-/m1/s1 |
| Inchi Key | GZCGUPFRVQAUEE-JGWLITMVSA-N |
| SMILES | C(C(C(C(C(C=O)O)O)O)O)O |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/ms-275.html |
| Additional Information | https://file.selleck.cn/downloads/struct/MS-275-Entinostat-chemical-structure-S1053.gif |
