Entinostat (MS-275)
Entinostat (MS-275, SNDX-275) strongly inhibits HDAC1 and HDAC3 with IC50 of 0.51 μM and 1.7 μM in cell-free assays, compared with HDACs 4, 6, 8, and 10. Entinostat induces autophagy and apoptosis. Phase 3.
| Trivial name | SNDX-275 |
| Catalog Number | S1053 |
| Molecular Formula | C25H24N2O2 |
| CAS# | 209783-80-2 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | O=C(CNC(=O)C1=CC=C(C=C1)C2=CC=CC=C2)NC3CCCC4=CC=CC=C34 |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/ms-275.html |
| Additional Information | https://file.selleck.cn/downloads/struct/MS-275-Entinostat-chemical-structure-S1053.gif |
