MS-275 (Entinostat) 10mM * 1mL in DMSO
MS-275 (Entinostat) is a potent HDAC inhibitor with IC50 of 0.3 and 8uM for HDAC1 and HDAC3, respectively.
| Trivial name | MS-275 (Entinostat) 10mM * 1mL in DMSO |
| Catalog Number | A10611-10mM-D |
| Alternative Name(s) | Pyridin-3-ylmethyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamat |
| Molecular Formula | C21H20N4O3 |
| CAS# | 209783-80-2 |
| SMILES | C1=CC=C(C(=C1)N)NC(=O)C2=CC=C(C=C2)CNC(=O)OCC3=CN=CC=C3 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ms-275-entinostat.html |