CPI-455 HCl
CPI-455 HCl is a specific KDM5 inhibitor with a half-maximal inhibitory concentration (IC50) of 10 ± 1 nM for full-length KDM5A in enzymatic assays, elevating global levels of H3K4 trimethylation (H3K4me3) and decreased the number of DTPs in multiple cancer cell line models treated with standard chemotherapy or targeted agents.
| Trivial name | N/A |
| Catalog Number | S8287 |
| Molecular Formula | C16H15ClN4O |
| CAS# | 2095432-28-1 |
| Inchi | InChI=1S/C16H14N4O.ClH/c1-10(2)13-14(11-6-4-3-5-7-11)19-15-12(8-17)9-18-20(15)16(13)21;/h3-7,9-10,19H,1-2H3;1H |
| Inchi Key | OMMDFEFIJLIEDY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N=C2C(=CNN2C1=O)C#N)C3=CC=CC=C3.Cl |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/cpi-455-hcl.html |
| Additional Information | https://file.selleck.cn/downloads/struct/cpi-455-chemical-structure-s8287.gif |