SB 258585 HCl 25mg
SB 258585 hydrochloride has been found to be a selective and potent SR-6 antagonist. This compound displays more than a 160-fold selectivity over other serotonin receptor subtypes.
| Trivial name | SB 258585 HCl 25mg |
| Catalog Number | A14026-25 |
| Alternative Name(s) | 4-iodo-N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]benzenesulfonamide hydrochloride |
| Molecular Formula | C18H22IN3O3S.HCl |
| CAS# | 209480-63-7 |
| SMILES | CN1CCN(CC1)C2=C(C=CC(=C2)NS(=O)(=O)C3=CC=C(C=C3)I)OC.Cl |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/sb-258585-hcl.html |