VX-745 10mM * 1mL in DMSO
VX-745 is a small-molecule inhibitor of MAPK that is reported to be active against several isotypes of p38 MAPK, including p38??, p38??and p38?? .
| Trivial name | VX-745 10mM * 1mL in DMSO |
| Catalog Number | A10983-10mM-D |
| Alternative Name(s) | 5-(2,6-Dichlorophenyl)-2-[2,4-difluorophenyl)thio]-6H-pyrimido[1,6-b]pyridazin-6-one |
| Molecular Formula | C19H9Cl2F2N3OS |
| CAS# | 209410-46-8 |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=C3C=CC(=NN3C=NC2=O)SC4=C(C=C(C=C4)F)F)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/vx-745.html |
