lsocryptomerin | MedChemExpress (MCE)
lsocryptomerin is a membrane-active antifungal compound that can be isolated from Selaginella tamariscina. lsocryptomerin can depolarize fungal plasma membrane. lsocryptomerin also shows anticancer and antibacterial activities[1][2].
| Trivial name | lsocryptomerin |
| Catalog Number | HY-N11506 |
| Research Area | Infection; Cancer |
| CAS# | 20931-58-2 |
| Purity | ≥98.00% |
| SMILES | O=C1C=C(C2=CC=C(OC3=C(C4=C(C=C3OC)OC(C5=CC=C(O)C=C5)=CC4=O)O)C=C2)OC6=C1C(O)=CC(O)=C6 |
| PubChem Chemical Structure ID | 5318537 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/lsocryptomerin.html |