Entecavir Monohydrate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-00229 |
| Alternative Name(s) | 2-Amino-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methyl-6-one hydrate (1:1) |
| Research Area | Antiviral used in the treatment of hepatitis B infection. |
| Molecular Formula | C12H17N5O4 |
| CAS# | 209216-23-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C=C([C@@H]1CO)[C@H](C[C@@H]1O)N2C(N=C(N)NC3=O)=C3N=C2.O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00229.html |
| Additional Information | NULL |