JWH 073 50mg
JWH 073 is a mildly selective agonist of the central cannabinoid (CB1) receptor derived from the aminoalkylindole WIN 55,212-2. The Ki values for binding CB1 and the peripheral cannabinoid (CB2) receptor are 8.9 and 38 nM, respectively for a CB1:CB2 ratio of 0.23
| Trivial name | JWH 073 50mg |
| Catalog Number | A14167-50 |
| Alternative Name(s) | (1-butyl-1H-indol-3-yl)-1-naphthalenyl-methanone |
| Molecular Formula | C23H21NO |
| CAS# | 208987-48-8 |
| SMILES | CCCCN1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43 |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/jwh-073.html |