15-epi-PGE1 | MedChemExpress (MCE)
15-epi-PGE1 (15R-Prostaglandin E1; 15-Epiprostaglandin E1) is a stereoisomer of PGE1 (HY-B0131) but with less biological activity[2]. 15-epi-PGE1 is a non-competitive inhibitor for human placental 15-Hydroxyprostaglandin dehydrogenase (15-PGDH) with an IC50 of 170 μM[1].
| Trivial name | 15-epi-PGE1 |
| Catalog Number | HY-116096 |
| Alternative Name(s) | 15(R)-Prostaglandin E1; 15-Epiprostaglandin E1 |
| Research Area | Others |
| CAS# | 20897-91-0 |
| Purity | ≥98.0% |
| SMILES | OC(CCCCCC[C@@H]1[C@H]([C@@H](CC1=O)O)/C=C/[C@H](O)CCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/15-epi-pge1.html |