(R)-ZINC-3573
ZINC-3573 is a potent and highly selective MRGPRX2 probe. ZINC-3573 activates endogenous MRGPRX2 in a human mast cell line, inducing degranulation and calcium release.
| Catalog Number | T29221 |
| Alternative Name(s) | ZINC 3573 |
| Research Area | Others |
| Molecular Formula | C18H21N5 |
| CAS# | 2089389-15-9 |
| Purity | 100.00% |
| SMILES | N(C)(C)[C@H]1CN(C=2N3C(N=C(C2)C4=CC=CC=C4)=CC=N3)CC1 |
| Size | 100 mg |
| Supplier Page | https://www.targetmol.com/compound/ZINC-3573 |
| Additional Information | https://www.targetmol.com/datasheet/T29221 |