CAQK peptide | MedChemExpress (MCE)
CAQK peptide selectively binds to injured mouse brain. CAQK peptide selectively targets demyelinating areas and it is absent from healthy tissue. The CAQK peptide target is a proteoglycan complex upregulated in brain injuries and is used for drug delivery. CAQK peptide can penetrate the blood-brain barrier[1][2].
| Trivial name | CAQK peptide |
| Catalog Number | HY-P10216 |
| Research Area | Others |
| CAS# | 2088281-24-5 |
| Purity | ≥98.0% |
| SMILES | O=C(N[C@@H](C)C(N[C@@H](CCC(N)=O)C(N[C@@H](CCCCN)C(O)=O)=O)=O)[C@H](CS)N |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/caqk-peptide.html |