JQ1-TCO | MedChemExpress (MCE)
JQ1-TCO (JQ1-trans-cyclooctene) is a derivative of JQ1 (HY-13030), an inhibitor of BET. JQ1-TCO is suitable for click chemistry and can be used as molecular probes in vitro and in vivo[1][2].
| Trivial name | JQ1-TCO |
| Catalog Number | HY-148864 |
| Research Area | Cancer |
| CAS# | 2087490-43-3 |
| Purity | ≥98.00% |
| SMILES | CC1=C(C)SC2=C1C(C3=CC=C(C=C3)Cl)=N[C@@H](CC(NCCCNC(OC4CCC/C=C\CC4)=O)=O)C5=NN=C(C)N25 |
| PubChem Chemical Structure ID | 153429422 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/jq1-tco.html |