Ermanin
Ermanin, a natural product isolated and purified from the herb of Tanacetum parthenium with anti-poliovirus activity, has a high deterrent activity at 40 ppm against Dione juno larvae.
| Trivial name | / |
| Catalog Number | CSN10042 |
| Alternative Name(s) | / |
| Research Area | Infection |
| Molecular Formula | C17H14O6 |
| CAS# | 20869-95-8 |
| Purity | ≥98% |
| SMILES | O=C1C(OC)=C(C2=CC=C(OC)C=C2)OC3=C1C(O)=CC(O)=C3 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/ermanin.html |