Micafungin Sodium
Micafungin sodium is an echinocandin antifungal drug, Micafungin inhibits the production of beta-1,3-glucan, an essential component of fungal cell walls.
| Trivial name | FK 463 Sodium; FK 463 |
| Catalog Number | CSN17309 |
| Alternative Name(s) | FK 463 Sodium; FK 463 |
| Research Area | Infection |
| Molecular Formula | C56H70N9NaO23S |
| CAS# | 208538-73-2 |
| Purity | ≥98% |
| SMILES | O=S(OC1=CC([C@@H]([C@H](C2NC(C3N(C[C@@H](C3)O)C(C([C@@H](C)O)NC([C@](C[C@H]([C@H](NC(C4N(C[C@@H]([C@@H]4O)C)C(C(NC2=O)[C@@H](CC(N)=O)O)=O)=O)O)O)(NC(C5=CC=C(C=C5)C6=NOC(C7=CC=C(C=C7)OCCCCC)=C6)=O)[H])=O)=O)=O)O)O)=CC=C1O)([O-])=O.[Na+] |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/micafungin-sodium.html |