Rp-8-pCPT-cGMPS sodium | MedChemExpress (MCE)
Rp-8-pCPT-cGMPS sodium is the sodium salt form of Rp-8-pCPT-cGMPS. Rp-8-pCPT-cGMPS is an inhibitor for cGMP-dependent protein kinase (cGK). Rp-8-pCPT-cGMPS sodium is an agonist for cyclic nucleotide-gated (CNG) channels in a voltage-dependent manner[1][2].
| Trivial name | Rp-8-pCPT-cGMPS sodium |
| Catalog Number | HY-110221 |
| Research Area | Neurological Disease |
| CAS# | 208445-07-2 |
| Purity | ≥98.0% |
| SMILES | O[C@H]1[C@](O[C@@](CO2)([H])[C@@]1([H])O[P@@]2(S[Na])=O)([H])N3C(NC(N)=NC4=O)=C4N=C3SC(C=C5)=CC=C5Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/rp-8-pcpt-cgmps-sodium.html |