Suc-YVAD-pNA | MedChemExpress (MCE)
Suc-YVAD-pNA is a substrate of ICE. Interleukin-1β-converting enzyme (ICE) is a cysteine protease responsible for the cleavage of pre-interleukin-1β (pre-IL-1β) to the mature cytokine and a member of a family of related proteases (the caspases)[1].
| Trivial name | Suc-YVAD-pNA |
| Catalog Number | HY-P2630 |
| Research Area | Inflammation/Immunology |
| CAS# | 208264-84-0 |
| Purity | ≥98.0% |
| SMILES | OC(C=C1)=CC=C1C[C@H](NC(CCC(O)=O)=O)C(N[C@@H](C(C)C)C(N[C@@H](C)C(N[C@@H](CC(O)=O)C(NC2=CC=C(C=C2)[N+]([O-])=O)=O)=O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/suc-yvad-pna.html |
