ZM 336372 100mg
ZM 336372 is a potent ATP-competitive inhibitor of Raf-1 in vitro (IC50 = 70 nM) with the paradoxical effect of inducing >100-fold activation of Raf-1 in whole cells.
| Trivial name | ZM 336372 100mg |
| Catalog Number | A11077-100 |
| Alternative Name(s) | 3-?€?(dimethylamino)-?€?N-?€?[3-?€?[(4-?€?hydroxybenzoyl)amino]-?€?4-?€?methylphenyl]-?€?benzamide |
| Molecular Formula | C23H23N3O3 |
| CAS# | 208260-29-1 |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=CC=C2)N(C)C)NC(=O)C3=CC=C(C=C3)O |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/zm-336372.html |