DAPT
DAPT is an inhibitor of γ-secretase and it can reduce the expression of Aβ40 and Aβ42 with IC50 values of 115 nM and 200 nM.
| Trivial name | LY-374973; GSI IX |
| Catalog Number | CSN13896 |
| Alternative Name(s) | LY-374973; GSI IX |
| Research Area | Neurological Disease |
| Molecular Formula | C23H26F2N2O4 |
| CAS# | 208255-80-5 |
| Purity | ≥99% |
| SMILES | O=C(OC(C)(C)C)[C@@H](NC([C@@H](NC(CC1=CC(F)=CC(F)=C1)=O)C)=O)C2=CC=CC=C2 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/dapt.html |
