4′-O-Methylbroussochalcone B
4′-O-Methylbavachalcone is a chalcone isolated from Psoralea corylifolia, which can inhibit severe acute respiratory syndrome coronavirus (SARS-CoV) papain-like protease (PLpro) activity, with an IC50 of 10.1 μM
| Trivial name | 4'-O-Methylbavachalcone |
| Catalog Number | CSN25476 |
| Alternative Name(s) | 4'-O-Methylbavachalcone |
| Research Area | Infection |
| Molecular Formula | C21H22O4 |
| CAS# | 20784-60-5 |
| Purity | ≥95% |
| SMILES | C/C(C)=C\CC1=CC(C(/C([H])=C([H])/C2=CC=C(O)C=C2)=O)=C(O)C=C1OC |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/4'-o-methylbroussochalcone-b.html |