(-)-Lavandulyl acetate | MedChemExpress (MCE)
(-)-Lavandulyl acetate is a nature product that can be found in Lavandula angustifolia. (-)-Lavandulyl acetate shows toxicity for mosquito vectors. (-)-Lavandulyl acetate can be used as mosquito larvicide[1][2].
| Trivial name | (-)-Lavandulyl acetate |
| Catalog Number | HY-117419 |
| Research Area | Infection |
| CAS# | 20777-39-3 |
| Purity | ≥98.00% |
| SMILES | CC(OC[C@H](C/C=C(C)\C)C(C)=C)=O |
| PubChem Chemical Structure ID | 14268092 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/minus-lavandulyl-acetate.html |