5-hydroxymethyl tolterodine 10mM * 1mL in DMSO
5-hydroxymethyl tolterodine is a metabolite of Tolterodine, a muscarinic receptor antagonist used in the treatment of urinary incontinence.
Trivial name | 5-hydroxymethyl tolterodine 10mM * 1mL in DMSO |
Catalog Number | A11166-10mM-D |
Alternative Name(s) | 3-[(1R)-3-[Bis(1-methylethyl)amino]-1-phenylpropyl]-4-hydroxybenzenemethanol |
Molecular Formula | C22H31NO2 |
CAS# | 207679-81-0 |
SMILES | CC(C)N(CC[C@H](C1=CC=CC=C1)C2=C(C=CC(=C2)CO)O)C(C)C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/5-hydroxymethyl-tolterodine-pnu-200577.html |