3-Bromocytisine
α4β4, α4β2 and α7 nACh receptor agonist Neuroscience|Nicotinic Receptor
| Catalog Number | B7423-50 |
| Research Area | Neuroscience|Nicotinic Receptor |
| Molecular Formula | C11H13BrN2O |
| CAS# | 207390-14-5 |
| Purity | 98% |
| SMILES | Br[C@H]1NC[C@H]2C[C@@H]1C(N3C2)=CC=CC3=O |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B7423 |
