Methyl Sinapate
Methyl sinapate, a natural product isolated and purified from the herbs of Rauvolfia tetraphylla, can increase the frequency of cells with chromosome aberrations in the CHO K-1 cells treated with MMC, 4NQO or UV.
| Trivial name | / |
| Catalog Number | CSN13033 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C12H14O5 |
| CAS# | 20733-94-2 |
| Purity | ≥98% |
| SMILES | O=C(OC)/C=C/C1=CC(OC)=C(O)C(OC)=C1 |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/methyl-sinapate.html |