KNI-1293 Biotin | MedChemExpress (MCE)
KNI-1293 Biotin is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| Trivial name | KNI-1293 Biotin |
| Catalog Number | HY-W127773 |
| Research Area | Others |
| CAS# | 2071715-99-4 |
| Purity | ≥98.00% |
| SMILES | N(C(=O)[C@H]1N(C([C@H]([C@H](CC2=CC=CC=C2)NC(COC3=C(C)C=C(NC(CCCC[C@H]4[C@@]5([C@](CS4)(NC(=O)N5)[H])[H])=O)C=C3C)=O)O)=O)CSC1(C)C)[C@H]6C=7C(C[C@H]6O)=CC=CC7 |
| PubChem Chemical Structure ID | 138376576 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kni-1293-biotin.html |