Luminol Sodium
Luminol Sodium is a chemical with chemiluminescence property, soluble in most polar organic solvents, insoluble in water. When mixed with an appropriate oxidizing agent, it emits a blue glow.
| Trivial name | Luminol Sodium Salt |
| Catalog Number | CSN17282 |
| Alternative Name(s) | Luminol Sodium Salt |
| Research Area | / |
| Molecular Formula | C8H6N3NaO2 |
| CAS# | 20666-12-0 |
| Purity | ≥99% |
| SMILES | O=C1NN(C(C2=C1C(N)=CC=C2)=O)[Na] |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/luminol-sodium.html |