Compstatin
Compstatin is a complement inhibitor which can bind C3 inhibiting proteolytic cleavage by C3 convertase with IC50 value of 28 μM and activate classical and alternative complement pathways with IC50 values of 63 and 12 μM, respectively.
| Trivial name | / |
| Catalog Number | CSN23354 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C66H99N23O17S2 |
| CAS# | 206645-99-0 |
| Purity | ≥99% |
| SMILES | O=C(N[C@H]1CC2=CNC3=C2C=CC=C3)[C@H](CC(O)=O)NC([C@]([H])(CCC(N)=O)NC([C@H](C(C)C)NC([C@H](C(C)C)NC([C@@H](NC([C@H]([C@H](CC)C)N)=O)CSSC[C@H](NC([C@@]([H])(NC([C@@H](NC([C@@]([H])(NC(CNC1=O)=O)CC4=CNC=N4)=O)CC5=CNC=N5)=O)CCCNC(N)=N)=O)C(N[C@@H]([C@@H](C)O)C(N)=O)=O)=O)=O)=O)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/compstatin.html |
