(S,R,S)-AHPC-PEG4-NH2 hydrochloride
(S,R,S)-AHPC-PEG4-NH2 hydrochloride (VH032-PEG4-NH2 hydrochloride, VHL Ligand-Linker Conjugates 4 hydrochloride, E3 ligase Ligand-Linker Conjugates 7) is a PROTAC E3 ligase ligand-linker conjugate that incorporates the (S,R,S)-AHPC based VHL ligand and 4-unit PEG linker.
| Trivial name | VH032-PEG4-NH2 hydrochloride, VHL Ligand-Linker Conjugates 4 hydrochloride, E3 ligase Ligand-Linker Conjugates 7 |
| Catalog Number | S3502 |
| Molecular Formula | C32H50ClN5O8S |
| CAS# | 2064292-52-8 |
| SMILES | Cl.CC1=C(SC=N1)C2=CC=C(CNC(=O)C3CC(O)CN3C(=O)C(NC(=O)COCCOCCOCCOCCN)C(C)(C)C)C=C2 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/-s-r-s-ahpc-peg4-nh2-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3502-s-r-s-ahpc-peg4-nh2-hydrochloride-chemical-structure.gif |